C24H22N2O3S2 — CID 158480369
methyl 3-amino-5-phenylthiophene-2-carboxylate;N-(5-phenylthiophen-3-yl)acetamide (PubChem CID 158480369) has the molecular formula C24H22N2O3S2 and a molecular weight of 450.59 g/mol. Its IUPAC name is methyl 3-amino-5-phenylthiophene-2-carboxylate;N-(5-phenylthiophen-3-yl)acetamide.
| Compound Name | methyl 3-amino-5-phenylthiophene-2-carboxylate;N-(5-phenylthiophen-3-yl)acetamide |
|---|---|
| PubChem CID | 158480369 |
| Molecular Formula | C24H22N2O3S2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | methyl 3-amino-5-phenylthiophene-2-carboxylate;N-(5-phenylthiophen-3-yl)acetamide |
| SMILES | CC(=O)Nc1csc(-c2ccccc2)c1.COC(=O)c1sc(-c2ccccc2)cc1N |
| InChI | InChI=1S/C12H11NO2S.C12H11NOS/c1-15-12(14)11-9(13)7-10(16-11)8-5-3-2-4-6-8;1-9(14)13-11-7-12(15-8-11)10-5-3-2-4-6-10/h2-7H,13H2,1H3;2-8H,1H3,(H,13,14) |
| InChIKey | HHLGPBUISRHBOV-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |