C17H12BrNO3S2 — CID 5018015
methyl 3-[(5-bromothiophene-2-carbonyl)amino]-5-phenylthiophene-2-carboxylate (PubChem CID 5018015) has the molecular formula C17H12BrNO3S2 and a molecular weight of 422.33 g/mol. Its IUPAC name is methyl 3-[(5-bromothiophene-2-carbonyl)amino]-5-phenylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(5-bromothiophene-2-carbonyl)amino]-5-phenylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 5018015 |
| Molecular Formula | C17H12BrNO3S2 |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 420.94 |
| IUPAC Name | methyl 3-[(5-bromothiophene-2-carbonyl)amino]-5-phenylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(-c2ccccc2)cc1NC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C17H12BrNO3S2/c1-22-17(21)15-11(19-16(20)12-7-8-14(18)23-12)9-13(24-15)10-5-3-2-4-6-10/h2-9H,1H3,(H,19,20) |
| InChIKey | LKHMBNYIXAKGMC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |