C23H19NO5S — CID 40888787
methyl 3-[(7-ethoxy-1-benzofuran-2-carbonyl)amino]-5-phenylthiophene-2-carboxylate (PubChem CID 40888787) has the molecular formula C23H19NO5S and a molecular weight of 421.47 g/mol. Its IUPAC name is methyl 3-[(7-ethoxy-1-benzofuran-2-carbonyl)amino]-5-phenylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(7-ethoxy-1-benzofuran-2-carbonyl)amino]-5-phenylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 40888787 |
| Molecular Formula | C23H19NO5S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | methyl 3-[(7-ethoxy-1-benzofuran-2-carbonyl)amino]-5-phenylthiophene-2-carboxylate |
| SMILES | CCOc1cccc2cc(C(=O)Nc3cc(-c4ccccc4)sc3C(=O)OC)oc12 |
| InChI | InChI=1S/C23H19NO5S/c1-3-28-17-11-7-10-15-12-18(29-20(15)17)22(25)24-16-13-19(14-8-5-4-6-9-14)30-21(16)23(26)27-2/h4-13H,3H2,1-2H3,(H,24,25) |
| InChIKey | RMQQRLLYHDKYKH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |