C26H18N2O3S2 — CID 4154099
methyl 5-phenyl-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiophene-2-carboxylate (PubChem CID 4154099) has the molecular formula C26H18N2O3S2 and a molecular weight of 470.58 g/mol. Its IUPAC name is methyl 5-phenyl-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 5-phenyl-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 4154099 |
| Molecular Formula | C26H18N2O3S2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | methyl 5-phenyl-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(-c2ccccc2)cc1NC(=O)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C26H18N2O3S2/c1-31-26(30)24-21(15-23(33-24)16-8-3-2-4-9-16)28-25(29)18-14-20(22-12-7-13-32-22)27-19-11-6-5-10-17(18)19/h2-15H,1H3,(H,28,29) |
| InChIKey | AHQHLBIVNMSUNI-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |