C21H13F3N2O2S — CID 18268811
2-thiophen-2-yl-N-[2-(trifluoromethoxy)phenyl]quinoline-4-carboxamide (PubChem CID 18268811) has the molecular formula C21H13F3N2O2S and a molecular weight of 414.41 g/mol. Its IUPAC name is 2-thiophen-2-yl-N-[2-(trifluoromethoxy)phenyl]quinoline-4-carboxamide.
| Compound Name | 2-thiophen-2-yl-N-[2-(trifluoromethoxy)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 18268811 |
| Molecular Formula | C21H13F3N2O2S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 2-thiophen-2-yl-N-[2-(trifluoromethoxy)phenyl]quinoline-4-carboxamide |
| SMILES | O=C(Nc1ccccc1OC(F)(F)F)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C21H13F3N2O2S/c22-21(23,24)28-18-9-4-3-8-16(18)26-20(27)14-12-17(19-10-5-11-29-19)25-15-7-2-1-6-13(14)15/h1-12H,(H,26,27) |
| InChIKey | ORNCMWWJSMFYGG-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |