C23H16F2N2O4S — CID 2129311
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate (PubChem CID 2129311) has the molecular formula C23H16F2N2O4S and a molecular weight of 454.45 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2129311 |
| Molecular Formula | C23H16F2N2O4S |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2cccs2)nc2ccccc12)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C23H16F2N2O4S/c24-23(25)31-19-9-4-3-8-17(19)27-21(28)13-30-22(29)15-12-18(20-10-5-11-32-20)26-16-7-2-1-6-14(15)16/h1-12,23H,13H2,(H,27,28) |
| InChIKey | VORZOBRWUPJTJB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |