C26H20N2O7S — CID 2353495
dimethyl 2-[[2-(2-thiophen-2-ylquinoline-4-carbonyl)oxyacetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 2353495) has the molecular formula C26H20N2O7S and a molecular weight of 504.52 g/mol. Its IUPAC name is dimethyl 2-[[2-(2-thiophen-2-ylquinoline-4-carbonyl)oxyacetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-(2-thiophen-2-ylquinoline-4-carbonyl)oxyacetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 2353495 |
| Molecular Formula | C26H20N2O7S |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | dimethyl 2-[[2-(2-thiophen-2-ylquinoline-4-carbonyl)oxyacetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)COC(=O)c2cc(-c3cccs3)nc3ccccc23)c1 |
| InChI | InChI=1S/C26H20N2O7S/c1-33-24(30)15-9-10-17(25(31)34-2)20(12-15)28-23(29)14-35-26(32)18-13-21(22-8-5-11-36-22)27-19-7-4-3-6-16(18)19/h3-13H,14H2,1-2H3,(H,28,29) |
| InChIKey | FVIWMQACILAVBE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|