C28H21BrN2O7 — CID 23906686
dimethyl 2-[[2-[2-(4-bromophenyl)quinoline-4-carbonyl]oxyacetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 23906686) has the molecular formula C28H21BrN2O7 and a molecular weight of 577.39 g/mol. Its IUPAC name is dimethyl 2-[[2-[2-(4-bromophenyl)quinoline-4-carbonyl]oxyacetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-[2-(4-bromophenyl)quinoline-4-carbonyl]oxyacetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 23906686 |
| Molecular Formula | C28H21BrN2O7 |
| Molecular Weight | 577.39 g/mol |
| Exact Mass | 576.05 |
| IUPAC Name | dimethyl 2-[[2-[2-(4-bromophenyl)quinoline-4-carbonyl]oxyacetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)COC(=O)c2cc(-c3ccc(Br)cc3)nc3ccccc23)c1 |
| InChI | InChI=1S/C28H21BrN2O7/c1-36-26(33)17-9-12-20(27(34)37-2)24(13-17)31-25(32)15-38-28(35)21-14-23(16-7-10-18(29)11-8-16)30-22-6-4-3-5-19(21)22/h3-14H,15H2,1-2H3,(H,31,32) |
| InChIKey | GJHALFSBZUIWSW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|