C22H14Br2N2O3S — CID 23992650
[2-(2,4-dibromoanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate (PubChem CID 23992650) has the molecular formula C22H14Br2N2O3S and a molecular weight of 546.24 g/mol. Its IUPAC name is [2-(2,4-dibromoanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate.
| Compound Name | [2-(2,4-dibromoanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 23992650 |
| Molecular Formula | C22H14Br2N2O3S |
| Molecular Weight | 546.24 g/mol |
| Exact Mass | 543.91 |
| IUPAC Name | [2-(2,4-dibromoanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2cccs2)nc2ccccc12)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C22H14Br2N2O3S/c23-13-7-8-18(16(24)10-13)26-21(27)12-29-22(28)15-11-19(20-6-3-9-30-20)25-17-5-2-1-4-14(15)17/h1-11H,12H2,(H,26,27) |
| InChIKey | IDPAQBNSZLZZAA-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.24 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |