C24H18N4O5S — CID 2569369
[2-(3,5-dicarbamoylanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate (PubChem CID 2569369) has the molecular formula C24H18N4O5S and a molecular weight of 474.50 g/mol. Its IUPAC name is [2-(3,5-dicarbamoylanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate.
| Compound Name | [2-(3,5-dicarbamoylanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2569369 |
| Molecular Formula | C24H18N4O5S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | [2-(3,5-dicarbamoylanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
| SMILES | NC(=O)c1cc(NC(=O)COC(=O)c2cc(-c3cccs3)nc3ccccc23)cc(C(N)=O)c1 |
| InChI | InChI=1S/C24H18N4O5S/c25-22(30)13-8-14(23(26)31)10-15(9-13)27-21(29)12-33-24(32)17-11-19(20-6-3-7-34-20)28-18-5-2-1-4-16(17)18/h1-11H,12H2,(H2,25,30)(H2,26,31)(H,27,29) |
| InChIKey | MLCBFDQQSXNESN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 154.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |