C22H15N3O5S — CID 23964464
[2-(4-nitroanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate (PubChem CID 23964464) has the molecular formula C22H15N3O5S and a molecular weight of 433.45 g/mol. Its IUPAC name is [2-(4-nitroanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate.
| Compound Name | [2-(4-nitroanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 23964464 |
| Molecular Formula | C22H15N3O5S |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | [2-(4-nitroanilino)-2-oxoethyl] 2-thiophen-2-ylquinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2cccs2)nc2ccccc12)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H15N3O5S/c26-21(23-14-7-9-15(10-8-14)25(28)29)13-30-22(27)17-12-19(20-6-3-11-31-20)24-18-5-2-1-4-16(17)18/h1-12H,13H2,(H,23,26) |
| InChIKey | VQYVRDLCTQGXFI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|