C22H15FN2O3S — CID 46519301
methyl 4-fluoro-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]benzoate (PubChem CID 46519301) has the molecular formula C22H15FN2O3S and a molecular weight of 406.44 g/mol. Its IUPAC name is methyl 4-fluoro-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]benzoate.
| Compound Name | methyl 4-fluoro-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 46519301 |
| Molecular Formula | C22H15FN2O3S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | methyl 4-fluoro-3-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(F)c(NC(=O)c2cc(-c3cccs3)nc3ccccc23)c1 |
| InChI | InChI=1S/C22H15FN2O3S/c1-28-22(27)13-8-9-16(23)18(11-13)25-21(26)15-12-19(20-7-4-10-29-20)24-17-6-3-2-5-14(15)17/h2-12H,1H3,(H,25,26) |
| InChIKey | AIPOMMUDYABBOC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |