C24H19N3O3 — CID 26198220
methyl 4-methyl-3-[(2-pyridin-4-ylquinoline-4-carbonyl)amino]benzoate (PubChem CID 26198220) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is methyl 4-methyl-3-[(2-pyridin-4-ylquinoline-4-carbonyl)amino]benzoate.
| Compound Name | methyl 4-methyl-3-[(2-pyridin-4-ylquinoline-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 26198220 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | methyl 4-methyl-3-[(2-pyridin-4-ylquinoline-4-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)c2cc(-c3ccncc3)nc3ccccc23)c1 |
| InChI | InChI=1S/C24H19N3O3/c1-15-7-8-17(24(29)30-2)13-21(15)27-23(28)19-14-22(16-9-11-25-12-10-16)26-20-6-4-3-5-18(19)20/h3-14H,1-2H3,(H,27,28) |
| InChIKey | FUPQHYIAOLRBNF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |