C25H19N2O3- — CID 5081114
4-methyl-3-[[2-(4-methylphenyl)quinoline-4-carbonyl]amino]benzoate (PubChem CID 5081114) has the molecular formula C25H19N2O3- and a molecular weight of 395.44 g/mol. Its IUPAC name is 4-methyl-3-[[2-(4-methylphenyl)quinoline-4-carbonyl]amino]benzoate.
| Compound Name | 4-methyl-3-[[2-(4-methylphenyl)quinoline-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 5081114 |
| Molecular Formula | C25H19N2O3- |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 4-methyl-3-[[2-(4-methylphenyl)quinoline-4-carbonyl]amino]benzoate |
| SMILES | Cc1ccc(-c2cc(C(=O)Nc3cc(C(=O)[O-])ccc3C)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H20N2O3/c1-15-7-10-17(11-8-15)23-14-20(19-5-3-4-6-21(19)26-23)24(28)27-22-13-18(25(29)30)12-9-16(22)2/h3-14H,1-2H3,(H,27,28)(H,29,30)/p-1 |
| InChIKey | WKYFCIGWIQNRQD-UHFFFAOYSA-M |
| XLogP | 4.13 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |