C21H15IN2OS — CID 2340923
N-(4-iodo-2-methylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 2340923) has the molecular formula C21H15IN2OS and a molecular weight of 470.34 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 2340923 |
| Molecular Formula | C21H15IN2OS |
| Molecular Weight | 470.34 g/mol |
| Exact Mass | 469.99 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C21H15IN2OS/c1-13-11-14(22)8-9-17(13)24-21(25)16-12-19(20-7-4-10-26-20)23-18-6-3-2-5-15(16)18/h2-12H,1H3,(H,24,25) |
| InChIKey | YUTVDEGMBOXDTH-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.34 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|