C27H20N2O3S2 — CID 3576372
methyl 4-(4-methylphenyl)-2-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 3576372) has the molecular formula C27H20N2O3S2 and a molecular weight of 484.60 g/mol. Its IUPAC name is methyl 4-(4-methylphenyl)-2-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-methylphenyl)-2-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3576372 |
| Molecular Formula | C27H20N2O3S2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | methyl 4-(4-methylphenyl)-2-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C27H20N2O3S2/c1-16-9-11-17(12-10-16)20-15-34-26(24(20)27(31)32-2)29-25(30)19-14-22(23-8-5-13-33-23)28-21-7-4-3-6-18(19)21/h3-15H,1-2H3,(H,29,30) |
| InChIKey | UBNIXANDCDORML-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|