C30H22Cl2N2O3S — CID 4217429
ethyl 2-[[2-(3,4-dichlorophenyl)quinoline-4-carbonyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 4217429) has the molecular formula C30H22Cl2N2O3S and a molecular weight of 561.49 g/mol. Its IUPAC name is ethyl 2-[[2-(3,4-dichlorophenyl)quinoline-4-carbonyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(3,4-dichlorophenyl)quinoline-4-carbonyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4217429 |
| Molecular Formula | C30H22Cl2N2O3S |
| Molecular Weight | 561.49 g/mol |
| Exact Mass | 560.07 |
| IUPAC Name | ethyl 2-[[2-(3,4-dichlorophenyl)quinoline-4-carbonyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)c1cc(-c2ccc(Cl)c(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C30H22Cl2N2O3S/c1-3-37-30(36)27-22(18-10-8-17(2)9-11-18)16-38-29(27)34-28(35)21-15-26(19-12-13-23(31)24(32)14-19)33-25-7-5-4-6-20(21)25/h4-16H,3H2,1-2H3,(H,34,35) |
| InChIKey | DJWZXTSVPGOJNE-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.49 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|