C33H29BrN2O3S — CID 3483390
ethyl 2-[[6-bromo-2-(4-propan-2-ylphenyl)quinoline-4-carbonyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 3483390) has the molecular formula C33H29BrN2O3S and a molecular weight of 613.58 g/mol. Its IUPAC name is ethyl 2-[[6-bromo-2-(4-propan-2-ylphenyl)quinoline-4-carbonyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[6-bromo-2-(4-propan-2-ylphenyl)quinoline-4-carbonyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3483390 |
| Molecular Formula | C33H29BrN2O3S |
| Molecular Weight | 613.58 g/mol |
| Exact Mass | 612.11 |
| IUPAC Name | ethyl 2-[[6-bromo-2-(4-propan-2-ylphenyl)quinoline-4-carbonyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)c1cc(-c2ccc(C(C)C)cc2)nc2ccc(Br)cc12 |
| InChI | InChI=1S/C33H29BrN2O3S/c1-5-39-33(38)30-27(22-8-6-20(4)7-9-22)18-40-32(30)36-31(37)26-17-29(23-12-10-21(11-13-23)19(2)3)35-28-15-14-24(34)16-25(26)28/h6-19H,5H2,1-4H3,(H,36,37) |
| InChIKey | GXBIHIVWCGFLRX-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.58 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|