C28H20ClN3O3S — CID 2359102
ethyl 4-(4-chlorophenyl)-2-[(2-pyridin-4-ylquinoline-4-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 2359102) has the molecular formula C28H20ClN3O3S and a molecular weight of 514.01 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-2-[(2-pyridin-4-ylquinoline-4-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-2-[(2-pyridin-4-ylquinoline-4-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2359102 |
| Molecular Formula | C28H20ClN3O3S |
| Molecular Weight | 514.01 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-2-[(2-pyridin-4-ylquinoline-4-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)c1cc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C28H20ClN3O3S/c1-2-35-28(34)25-22(17-7-9-19(29)10-8-17)16-36-27(25)32-26(33)21-15-24(18-11-13-30-14-12-18)31-23-6-4-3-5-20(21)23/h3-16H,2H2,1H3,(H,32,33) |
| InChIKey | XICAEQJSHPYDCB-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.01 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|