C30H24N2O3S — CID 4167519
methyl 4-(4-methylphenyl)-2-[[2-(3-methylphenyl)quinoline-4-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 4167519) has the molecular formula C30H24N2O3S and a molecular weight of 492.60 g/mol. Its IUPAC name is methyl 4-(4-methylphenyl)-2-[[2-(3-methylphenyl)quinoline-4-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-methylphenyl)-2-[[2-(3-methylphenyl)quinoline-4-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4167519 |
| Molecular Formula | C30H24N2O3S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | methyl 4-(4-methylphenyl)-2-[[2-(3-methylphenyl)quinoline-4-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)c1cc(-c2cccc(C)c2)nc2ccccc12 |
| InChI | InChI=1S/C30H24N2O3S/c1-18-11-13-20(14-12-18)24-17-36-29(27(24)30(34)35-3)32-28(33)23-16-26(21-8-6-7-19(2)15-21)31-25-10-5-4-9-22(23)25/h4-17H,1-3H3,(H,32,33) |
| InChIKey | FCLHRTKWZHBCRM-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|