C28H19BrN2O3S — CID 3554815
methyl 2-[[2-(3-bromophenyl)quinoline-4-carbonyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 3554815) has the molecular formula C28H19BrN2O3S and a molecular weight of 543.44 g/mol. Its IUPAC name is methyl 2-[[2-(3-bromophenyl)quinoline-4-carbonyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(3-bromophenyl)quinoline-4-carbonyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3554815 |
| Molecular Formula | C28H19BrN2O3S |
| Molecular Weight | 543.44 g/mol |
| Exact Mass | 542.03 |
| IUPAC Name | methyl 2-[[2-(3-bromophenyl)quinoline-4-carbonyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2)csc1NC(=O)c1cc(-c2cccc(Br)c2)nc2ccccc12 |
| InChI | InChI=1S/C28H19BrN2O3S/c1-34-28(33)25-22(17-8-3-2-4-9-17)16-35-27(25)31-26(32)21-15-24(18-10-7-11-19(29)14-18)30-23-13-6-5-12-20(21)23/h2-16H,1H3,(H,31,32) |
| InChIKey | NGMNUXPAYPKHGS-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.44 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|