C30H23BrN2O5S — CID 3580852
methyl 2-[[6-bromo-2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate (PubChem CID 3580852) has the molecular formula C30H23BrN2O5S and a molecular weight of 603.49 g/mol. Its IUPAC name is methyl 2-[[6-bromo-2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[6-bromo-2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3580852 |
| Molecular Formula | C30H23BrN2O5S |
| Molecular Weight | 603.49 g/mol |
| Exact Mass | 602.05 |
| IUPAC Name | methyl 2-[[6-bromo-2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(OC)cc2)csc1NC(=O)c1cc(-c2ccc(OC)cc2)nc2ccc(Br)cc12 |
| InChI | InChI=1S/C30H23BrN2O5S/c1-36-20-9-4-17(5-10-20)24-16-39-29(27(24)30(35)38-3)33-28(34)23-15-26(18-6-11-21(37-2)12-7-18)32-25-13-8-19(31)14-22(23)25/h4-16H,1-3H3,(H,33,34) |
| InChIKey | QROMTCIKSABULL-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.49 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|