C30H21BrCl2N2O3S — CID 4650685
propan-2-yl 2-[(6-bromo-2-phenylquinoline-4-carbonyl)amino]-4-(3,4-dichlorophenyl)thiophene-3-carboxylate (PubChem CID 4650685) has the molecular formula C30H21BrCl2N2O3S and a molecular weight of 640.39 g/mol. Its IUPAC name is propan-2-yl 2-[(6-bromo-2-phenylquinoline-4-carbonyl)amino]-4-(3,4-dichlorophenyl)thiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[(6-bromo-2-phenylquinoline-4-carbonyl)amino]-4-(3,4-dichlorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4650685 |
| Molecular Formula | C30H21BrCl2N2O3S |
| Molecular Weight | 640.39 g/mol |
| Exact Mass | 637.98 |
| IUPAC Name | propan-2-yl 2-[(6-bromo-2-phenylquinoline-4-carbonyl)amino]-4-(3,4-dichlorophenyl)thiophene-3-carboxylate |
| SMILES | CC(C)OC(=O)c1c(-c2ccc(Cl)c(Cl)c2)csc1NC(=O)c1cc(-c2ccccc2)nc2ccc(Br)cc12 |
| InChI | InChI=1S/C30H21BrCl2N2O3S/c1-16(2)38-30(37)27-22(18-8-10-23(32)24(33)12-18)15-39-29(27)35-28(36)21-14-26(17-6-4-3-5-7-17)34-25-11-9-19(31)13-20(21)25/h3-16H,1-2H3,(H,35,36) |
| InChIKey | JROHQPXZHMNWHU-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.39 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|