C32H28N2O4S — CID 3512596
methyl 2-[[2-(3,4-dimethylphenyl)quinoline-4-carbonyl]amino]-4-(4-ethoxyphenyl)thiophene-3-carboxylate (PubChem CID 3512596) has the molecular formula C32H28N2O4S and a molecular weight of 536.65 g/mol. Its IUPAC name is methyl 2-[[2-(3,4-dimethylphenyl)quinoline-4-carbonyl]amino]-4-(4-ethoxyphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(3,4-dimethylphenyl)quinoline-4-carbonyl]amino]-4-(4-ethoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3512596 |
| Molecular Formula | C32H28N2O4S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | methyl 2-[[2-(3,4-dimethylphenyl)quinoline-4-carbonyl]amino]-4-(4-ethoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCOc1ccc(-c2csc(NC(=O)c3cc(-c4ccc(C)c(C)c4)nc4ccccc34)c2C(=O)OC)cc1 |
| InChI | InChI=1S/C32H28N2O4S/c1-5-38-23-14-12-21(13-15-23)26-18-39-31(29(26)32(36)37-4)34-30(35)25-17-28(22-11-10-19(2)20(3)16-22)33-27-9-7-6-8-24(25)27/h6-18H,5H2,1-4H3,(H,34,35) |
| InChIKey | NVJKZRVOYOVCDK-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|