C31H26N2O3S — CID 3476447
ethyl 2-[[2-(3,4-dimethylphenyl)quinoline-4-carbonyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 3476447) has the molecular formula C31H26N2O3S and a molecular weight of 506.63 g/mol. Its IUPAC name is ethyl 2-[[2-(3,4-dimethylphenyl)quinoline-4-carbonyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(3,4-dimethylphenyl)quinoline-4-carbonyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3476447 |
| Molecular Formula | C31H26N2O3S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | ethyl 2-[[2-(3,4-dimethylphenyl)quinoline-4-carbonyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)c1cc(-c2ccc(C)c(C)c2)nc2ccccc12 |
| InChI | InChI=1S/C31H26N2O3S/c1-4-36-31(35)28-25(21-10-6-5-7-11-21)18-37-30(28)33-29(34)24-17-27(22-15-14-19(2)20(3)16-22)32-26-13-9-8-12-23(24)26/h5-18H,4H2,1-3H3,(H,33,34) |
| InChIKey | ZNGCSHANTSAYKA-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|