C27H19ClN2O3S2 — CID 4227698
ethyl 4-(4-chlorophenyl)-2-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 4227698) has the molecular formula C27H19ClN2O3S2 and a molecular weight of 519.05 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-2-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-2-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4227698 |
| Molecular Formula | C27H19ClN2O3S2 |
| Molecular Weight | 519.05 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-2-[(2-thiophen-2-ylquinoline-4-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C27H19ClN2O3S2/c1-2-33-27(32)24-20(16-9-11-17(28)12-10-16)15-35-26(24)30-25(31)19-14-22(23-8-5-13-34-23)29-21-7-4-3-6-18(19)21/h3-15H,2H2,1H3,(H,30,31) |
| InChIKey | GLTAKOQKNPEKKL-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.05 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|