C31H25FN2O3S — CID 3621918
ethyl 2-[[2-(4-ethylphenyl)quinoline-4-carbonyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate (PubChem CID 3621918) has the molecular formula C31H25FN2O3S and a molecular weight of 524.62 g/mol. Its IUPAC name is ethyl 2-[[2-(4-ethylphenyl)quinoline-4-carbonyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(4-ethylphenyl)quinoline-4-carbonyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3621918 |
| Molecular Formula | C31H25FN2O3S |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | ethyl 2-[[2-(4-ethylphenyl)quinoline-4-carbonyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)c1cc(-c2ccc(CC)cc2)nc2ccccc12 |
| InChI | InChI=1S/C31H25FN2O3S/c1-3-19-9-11-21(12-10-19)27-17-24(23-7-5-6-8-26(23)33-27)29(35)34-30-28(31(36)37-4-2)25(18-38-30)20-13-15-22(32)16-14-20/h5-18H,3-4H2,1-2H3,(H,34,35) |
| InChIKey | SIKSCINBSPYHAO-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|