C28H21FN2O4S — CID 3705182
ethyl 4-(4-fluorophenyl)-2-[[2-(5-methylfuran-2-yl)quinoline-4-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 3705182) has the molecular formula C28H21FN2O4S and a molecular weight of 500.55 g/mol. Its IUPAC name is ethyl 4-(4-fluorophenyl)-2-[[2-(5-methylfuran-2-yl)quinoline-4-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-fluorophenyl)-2-[[2-(5-methylfuran-2-yl)quinoline-4-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3705182 |
| Molecular Formula | C28H21FN2O4S |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | ethyl 4-(4-fluorophenyl)-2-[[2-(5-methylfuran-2-yl)quinoline-4-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)c1cc(-c2ccc(C)o2)nc2ccccc12 |
| InChI | InChI=1S/C28H21FN2O4S/c1-3-34-28(33)25-21(17-9-11-18(29)12-10-17)15-36-27(25)31-26(32)20-14-23(24-13-8-16(2)35-24)30-22-7-5-4-6-19(20)22/h4-15H,3H2,1-2H3,(H,31,32) |
| InChIKey | DVDFYYCIDURZNZ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|