C29H22N2O6S — CID 2468808
[2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 2468808) has the molecular formula C29H22N2O6S and a molecular weight of 526.57 g/mol. Its IUPAC name is [2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | [2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2468808 |
| Molecular Formula | C29H22N2O6S |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | [2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)COC(=O)c1cc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C29H22N2O6S/c1-2-35-29(34)26-21(18-9-4-3-5-10-18)17-38-27(26)31-25(32)16-37-28(33)20-15-23(24-13-8-14-36-24)30-22-12-7-6-11-19(20)22/h3-15,17H,2,16H2,1H3,(H,31,32) |
| InChIKey | JJEIEDGQDIZMSC-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|