C23H18N2O4 — CID 1222332
ethyl 2-[[2-(furan-2-yl)quinoline-4-carbonyl]amino]benzoate (PubChem CID 1222332) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is ethyl 2-[[2-(furan-2-yl)quinoline-4-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-(furan-2-yl)quinoline-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 1222332 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | ethyl 2-[[2-(furan-2-yl)quinoline-4-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1cc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C23H18N2O4/c1-2-28-23(27)16-9-4-6-11-19(16)25-22(26)17-14-20(21-12-7-13-29-21)24-18-10-5-3-8-15(17)18/h3-14H,2H2,1H3,(H,25,26) |
| InChIKey | OQCDLXPHYWKYBC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |