C23H19N3O3S — CID 17374077
ethyl 5-methyl-2-[(2-pyridin-4-ylquinoline-4-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 17374077) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is ethyl 5-methyl-2-[(2-pyridin-4-ylquinoline-4-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-methyl-2-[(2-pyridin-4-ylquinoline-4-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17374077 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | ethyl 5-methyl-2-[(2-pyridin-4-ylquinoline-4-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)sc1NC(=O)c1cc(-c2ccncc2)nc2ccccc12 |
| InChI | InChI=1S/C23H19N3O3S/c1-3-29-23(28)18-12-14(2)30-22(18)26-21(27)17-13-20(15-8-10-24-11-9-15)25-19-7-5-4-6-16(17)19/h4-13H,3H2,1-2H3,(H,26,27) |
| InChIKey | ONHRMERZRBLDOK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |