C25H20N2O5S2 — CID 121040700
methyl 3-[[2-(benzenesulfonamido)benzoyl]amino]-5-phenylthiophene-2-carboxylate (PubChem CID 121040700) has the molecular formula C25H20N2O5S2 and a molecular weight of 492.58 g/mol. Its IUPAC name is methyl 3-[[2-(benzenesulfonamido)benzoyl]amino]-5-phenylthiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-(benzenesulfonamido)benzoyl]amino]-5-phenylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 121040700 |
| Molecular Formula | C25H20N2O5S2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | methyl 3-[[2-(benzenesulfonamido)benzoyl]amino]-5-phenylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(-c2ccccc2)cc1NC(=O)c1ccccc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H20N2O5S2/c1-32-25(29)23-21(16-22(33-23)17-10-4-2-5-11-17)26-24(28)19-14-8-9-15-20(19)27-34(30,31)18-12-6-3-7-13-18/h2-16,27H,1H3,(H,26,28) |
| InChIKey | RKJHLFHQSKCWCO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |