C20H17ClN2O3S — CID 2977231
2-(benzenesulfonamido)-N-(5-chloro-2-methylphenyl)benzamide (PubChem CID 2977231) has the molecular formula C20H17ClN2O3S and a molecular weight of 400.89 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-(5-chloro-2-methylphenyl)benzamide.
| Compound Name | 2-(benzenesulfonamido)-N-(5-chloro-2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 2977231 |
| Molecular Formula | C20H17ClN2O3S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 2-(benzenesulfonamido)-N-(5-chloro-2-methylphenyl)benzamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)c1ccccc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H17ClN2O3S/c1-14-11-12-15(21)13-19(14)22-20(24)17-9-5-6-10-18(17)23-27(25,26)16-7-3-2-4-8-16/h2-13,23H,1H3,(H,22,24) |
| InChIKey | DVZIUWZIWGXHAZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |