C20H16Cl2N2O3S — CID 158200671
N-(2,4-dichlorophenyl)-2-[(3-methylphenyl)sulfonylamino]benzamide (PubChem CID 158200671) has the molecular formula C20H16Cl2N2O3S and a molecular weight of 435.33 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[(3-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[(3-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 158200671 |
| Molecular Formula | C20H16Cl2N2O3S |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[(3-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1cccc(S(=O)(=O)Nc2ccccc2C(=O)Nc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C20H16Cl2N2O3S/c1-13-5-4-6-15(11-13)28(26,27)24-18-8-3-2-7-16(18)20(25)23-19-10-9-14(21)12-17(19)22/h2-12,24H,1H3,(H,23,25) |
| InChIKey | WECOVMHFHHFWND-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |