C20H13Cl2F3N2O4S — CID 135379015
N-(2,4-dichlorophenyl)-2-[[3-(trifluoromethoxy)phenyl]sulfonylamino]benzamide (PubChem CID 135379015) has the molecular formula C20H13Cl2F3N2O4S and a molecular weight of 505.30 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[[3-(trifluoromethoxy)phenyl]sulfonylamino]benzamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[[3-(trifluoromethoxy)phenyl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 135379015 |
| Molecular Formula | C20H13Cl2F3N2O4S |
| Molecular Weight | 505.30 g/mol |
| Exact Mass | 503.99 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[[3-(trifluoromethoxy)phenyl]sulfonylamino]benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1ccccc1NS(=O)(=O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C20H13Cl2F3N2O4S/c21-12-8-9-18(16(22)10-12)26-19(28)15-6-1-2-7-17(15)27-32(29,30)14-5-3-4-13(11-14)31-20(23,24)25/h1-11,27H,(H,26,28) |
| InChIKey | QBLZRHGJTHFRSG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.30 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |