C20H14Cl3F3N2O3S — CID 171344003
N-[2-[(3,4,5-trichloroanilino)methyl]phenyl]-3-(trifluoromethoxy)benzenesulfonamide (PubChem CID 171344003) has the molecular formula C20H14Cl3F3N2O3S and a molecular weight of 525.76 g/mol. Its IUPAC name is N-[2-[(3,4,5-trichloroanilino)methyl]phenyl]-3-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[2-[(3,4,5-trichloroanilino)methyl]phenyl]-3-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 171344003 |
| Molecular Formula | C20H14Cl3F3N2O3S |
| Molecular Weight | 525.76 g/mol |
| Exact Mass | 523.97 |
| IUPAC Name | N-[2-[(3,4,5-trichloroanilino)methyl]phenyl]-3-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1CNc1cc(Cl)c(Cl)c(Cl)c1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C20H14Cl3F3N2O3S/c21-16-8-13(9-17(22)19(16)23)27-11-12-4-1-2-7-18(12)28-32(29,30)15-6-3-5-14(10-15)31-20(24,25)26/h1-10,27-28H,11H2 |
| InChIKey | WXQBUFDKNJWMJB-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.76 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|