C20H16Cl2N2O3S2 — CID 54471115
5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-(2-methylsulfanylphenyl)benzamide (PubChem CID 54471115) has the molecular formula C20H16Cl2N2O3S2 and a molecular weight of 467.40 g/mol. Its IUPAC name is 5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-(2-methylsulfanylphenyl)benzamide.
| Compound Name | 5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-(2-methylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 54471115 |
| Molecular Formula | C20H16Cl2N2O3S2 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | 5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-(2-methylsulfanylphenyl)benzamide |
| SMILES | CSc1ccccc1NC(=O)c1cc(Cl)ccc1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H16Cl2N2O3S2/c1-28-19-5-3-2-4-18(19)23-20(25)16-12-14(22)8-11-17(16)24-29(26,27)15-9-6-13(21)7-10-15/h2-12,24H,1H3,(H,23,25) |
| InChIKey | XIKYOCPBWHQPSZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |