C19H11Cl2F3N2O3S — CID 22646340
5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 22646340) has the molecular formula C19H11Cl2F3N2O3S and a molecular weight of 475.28 g/mol. Its IUPAC name is 5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 22646340 |
| Molecular Formula | C19H11Cl2F3N2O3S |
| Molecular Weight | 475.28 g/mol |
| Exact Mass | 473.98 |
| IUPAC Name | 5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1cc(Cl)ccc1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H11Cl2F3N2O3S/c20-10-1-4-13(5-2-10)30(28,29)26-17-6-3-11(21)7-14(17)19(27)25-12-8-15(22)18(24)16(23)9-12/h1-9,26H,(H,25,27) |
| InChIKey | MXSGHVZEEDWWRH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.28 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|