C29H20Cl2N2O4S — CID 139818443
5-chloro-N-[4-(4-chlorophenoxy)phenyl]-2-(naphthalen-2-ylsulfonylamino)benzamide (PubChem CID 139818443) has the molecular formula C29H20Cl2N2O4S and a molecular weight of 563.46 g/mol. Its IUPAC name is 5-chloro-N-[4-(4-chlorophenoxy)phenyl]-2-(naphthalen-2-ylsulfonylamino)benzamide.
| Compound Name | 5-chloro-N-[4-(4-chlorophenoxy)phenyl]-2-(naphthalen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 139818443 |
| Molecular Formula | C29H20Cl2N2O4S |
| Molecular Weight | 563.46 g/mol |
| Exact Mass | 562.05 |
| IUPAC Name | 5-chloro-N-[4-(4-chlorophenoxy)phenyl]-2-(naphthalen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(Nc1ccc(Oc2ccc(Cl)cc2)cc1)c1cc(Cl)ccc1NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H20Cl2N2O4S/c30-21-6-11-24(12-7-21)37-25-13-9-23(10-14-25)32-29(34)27-18-22(31)8-16-28(27)33-38(35,36)26-15-5-19-3-1-2-4-20(19)17-26/h1-18,33H,(H,32,34) |
| InChIKey | WTDTXOUOEIZNSV-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.46 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |