C25H17Cl3N2O4S — CID 11519607
N-(4-chlorophenyl)-2-[(2,5-dichlorophenyl)sulfonylamino]-5-phenoxybenzamide (PubChem CID 11519607) has the molecular formula C25H17Cl3N2O4S and a molecular weight of 547.85 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(2,5-dichlorophenyl)sulfonylamino]-5-phenoxybenzamide.
| Compound Name | N-(4-chlorophenyl)-2-[(2,5-dichlorophenyl)sulfonylamino]-5-phenoxybenzamide |
|---|---|
| PubChem CID | 11519607 |
| Molecular Formula | C25H17Cl3N2O4S |
| Molecular Weight | 547.85 g/mol |
| Exact Mass | 546.00 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(2,5-dichlorophenyl)sulfonylamino]-5-phenoxybenzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cc(Oc2ccccc2)ccc1NS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C25H17Cl3N2O4S/c26-16-6-9-18(10-7-16)29-25(31)21-15-20(34-19-4-2-1-3-5-19)11-13-23(21)30-35(32,33)24-14-17(27)8-12-22(24)28/h1-15,30H,(H,29,31) |
| InChIKey | LXKONRBOLRDVFS-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.85 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |