C17H12Cl2N2O3S — CID 155812324
2,5-dichloro-N-(2-phenoxy-3-pyridinyl)benzenesulfonamide (PubChem CID 155812324) has the molecular formula C17H12Cl2N2O3S and a molecular weight of 395.27 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-phenoxy-3-pyridinyl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(2-phenoxy-3-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 155812324 |
| Molecular Formula | C17H12Cl2N2O3S |
| Molecular Weight | 395.27 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 2,5-dichloro-N-(2-phenoxy-3-pyridinyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccnc1Oc1ccccc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H12Cl2N2O3S/c18-12-8-9-14(19)16(11-12)25(22,23)21-15-7-4-10-20-17(15)24-13-5-2-1-3-6-13/h1-11,21H |
| InChIKey | ZNOMEUOLPZYIKL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.27 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |