C20H16ClN3O3S — CID 55896349
5-chloro-N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-2-methylbenzenesulfonamide (PubChem CID 55896349) has the molecular formula C20H16ClN3O3S and a molecular weight of 413.89 g/mol. Its IUPAC name is 5-chloro-N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-2-methylbenzenesulfonamide.
| Compound Name | 5-chloro-N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 55896349 |
| Molecular Formula | C20H16ClN3O3S |
| Molecular Weight | 413.89 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 5-chloro-N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(Oc2ncccc2C#N)ccc1NS(=O)(=O)c1cc(Cl)ccc1C |
| InChI | InChI=1S/C20H16ClN3O3S/c1-13-5-6-16(21)11-19(13)28(25,26)24-18-8-7-17(10-14(18)2)27-20-15(12-22)4-3-9-23-20/h3-11,24H,1-2H3 |
| InChIKey | DVQMQLNLNJCWIA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.89 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |