C21H14N4O5S — CID 56560913
N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-1,3-dioxoisoindole-5-sulfonamide (PubChem CID 56560913) has the molecular formula C21H14N4O5S and a molecular weight of 434.43 g/mol. Its IUPAC name is N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-1,3-dioxoisoindole-5-sulfonamide.
| Compound Name | N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-1,3-dioxoisoindole-5-sulfonamide |
|---|---|
| PubChem CID | 56560913 |
| Molecular Formula | C21H14N4O5S |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-1,3-dioxoisoindole-5-sulfonamide |
| SMILES | Cc1cc(Oc2ncccc2C#N)ccc1NS(=O)(=O)c1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C21H14N4O5S/c1-12-9-14(30-21-13(11-22)3-2-8-23-21)4-7-18(12)25-31(28,29)15-5-6-16-17(10-15)20(27)24-19(16)26/h2-10,25H,1H3,(H,24,26,27) |
| InChIKey | CMXOFRHATBNCCP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 138.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|