C15H12N2O5S — CID 100820383
N-(4-hydroxy-2-methylphenyl)-1,3-dioxoisoindole-5-sulfonamide (PubChem CID 100820383) has the molecular formula C15H12N2O5S and a molecular weight of 332.34 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylphenyl)-1,3-dioxoisoindole-5-sulfonamide.
| Compound Name | N-(4-hydroxy-2-methylphenyl)-1,3-dioxoisoindole-5-sulfonamide |
|---|---|
| PubChem CID | 100820383 |
| Molecular Formula | C15H12N2O5S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-(4-hydroxy-2-methylphenyl)-1,3-dioxoisoindole-5-sulfonamide |
| SMILES | Cc1cc(O)ccc1NS(=O)(=O)c1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C15H12N2O5S/c1-8-6-9(18)2-5-13(8)17-23(21,22)10-3-4-11-12(7-10)15(20)16-14(11)19/h2-7,17-18H,1H3,(H,16,19,20) |
| InChIKey | TVPNKGADVBOUED-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|