C16H16N4O6S2 — CID 56582379
N-[2-(methylamino)-5-(methylsulfamoyl)phenyl]-1,3-dioxoisoindole-5-sulfonamide (PubChem CID 56582379) has the molecular formula C16H16N4O6S2 and a molecular weight of 424.46 g/mol. Its IUPAC name is N-[2-(methylamino)-5-(methylsulfamoyl)phenyl]-1,3-dioxoisoindole-5-sulfonamide.
| Compound Name | N-[2-(methylamino)-5-(methylsulfamoyl)phenyl]-1,3-dioxoisoindole-5-sulfonamide |
|---|---|
| PubChem CID | 56582379 |
| Molecular Formula | C16H16N4O6S2 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | N-[2-(methylamino)-5-(methylsulfamoyl)phenyl]-1,3-dioxoisoindole-5-sulfonamide |
| SMILES | CNc1ccc(S(=O)(=O)NC)cc1NS(=O)(=O)c1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C16H16N4O6S2/c1-17-13-6-4-10(27(23,24)18-2)8-14(13)20-28(25,26)9-3-5-11-12(7-9)16(22)19-15(11)21/h3-8,17-18,20H,1-2H3,(H,19,21,22) |
| InChIKey | AXCFAEWOWYXJRL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|