C11H12N2O5S — CID 100820371
N-(3-hydroxypropyl)-1,3-dioxoisoindole-5-sulfonamide (PubChem CID 100820371) has the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-1,3-dioxoisoindole-5-sulfonamide.
| Compound Name | N-(3-hydroxypropyl)-1,3-dioxoisoindole-5-sulfonamide |
|---|---|
| PubChem CID | 100820371 |
| Molecular Formula | C11H12N2O5S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | N-(3-hydroxypropyl)-1,3-dioxoisoindole-5-sulfonamide |
| SMILES | O=C1NC(=O)c2cc(S(=O)(=O)NCCCO)ccc21 |
| InChI | InChI=1S/C11H12N2O5S/c14-5-1-4-12-19(17,18)7-2-3-8-9(6-7)11(16)13-10(8)15/h2-3,6,12,14H,1,4-5H2,(H,13,15,16) |
| InChIKey | HVCKNPUPUQKSEE-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|