C19H24N2O6S2 — CID 654673
2-N,7-N-bis(3-hydroxypropyl)-9H-fluorene-2,7-disulfonamide (PubChem CID 654673) has the molecular formula C19H24N2O6S2 and a molecular weight of 440.54 g/mol. Its IUPAC name is 2-N,7-N-bis(3-hydroxypropyl)-9H-fluorene-2,7-disulfonamide.
| Compound Name | 2-N,7-N-bis(3-hydroxypropyl)-9H-fluorene-2,7-disulfonamide |
|---|---|
| PubChem CID | 654673 |
| Molecular Formula | C19H24N2O6S2 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 2-N,7-N-bis(3-hydroxypropyl)-9H-fluorene-2,7-disulfonamide |
| SMILES | O=S(=O)(NCCCO)c1ccc2c(c1)Cc1cc(S(=O)(=O)NCCCO)ccc1-2 |
| InChI | InChI=1S/C19H24N2O6S2/c22-9-1-7-20-28(24,25)16-3-5-18-14(12-16)11-15-13-17(4-6-19(15)18)29(26,27)21-8-2-10-23/h3-6,12-13,20-23H,1-2,7-11H2 |
| InChIKey | QCWVYDXEYQXJNS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|