C27H24N2O4S2 — CID 1102995
2-N,7-N-dibenzyl-9H-fluorene-2,7-disulfonamide (PubChem CID 1102995) has the molecular formula C27H24N2O4S2 and a molecular weight of 504.63 g/mol. Its IUPAC name is 2-N,7-N-dibenzyl-9H-fluorene-2,7-disulfonamide.
| Compound Name | 2-N,7-N-dibenzyl-9H-fluorene-2,7-disulfonamide |
|---|---|
| PubChem CID | 1102995 |
| Molecular Formula | C27H24N2O4S2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 2-N,7-N-dibenzyl-9H-fluorene-2,7-disulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1)c1ccc2c(c1)Cc1cc(S(=O)(=O)NCc3ccccc3)ccc1-2 |
| InChI | InChI=1S/C27H24N2O4S2/c30-34(31,28-18-20-7-3-1-4-8-20)24-11-13-26-22(16-24)15-23-17-25(12-14-27(23)26)35(32,33)29-19-21-9-5-2-6-10-21/h1-14,16-17,28-29H,15,18-19H2 |
| InChIKey | ZBYBWHSABKGIMQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |