C21H28N2O6S2 — CID 1154512
2-N,7-N-bis(1-hydroxy-2-methylpropan-2-yl)-9H-fluorene-2,7-disulfonamide (PubChem CID 1154512) has the molecular formula C21H28N2O6S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 2-N,7-N-bis(1-hydroxy-2-methylpropan-2-yl)-9H-fluorene-2,7-disulfonamide.
| Compound Name | 2-N,7-N-bis(1-hydroxy-2-methylpropan-2-yl)-9H-fluorene-2,7-disulfonamide |
|---|---|
| PubChem CID | 1154512 |
| Molecular Formula | C21H28N2O6S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 2-N,7-N-bis(1-hydroxy-2-methylpropan-2-yl)-9H-fluorene-2,7-disulfonamide |
| SMILES | CC(C)(CO)NS(=O)(=O)c1ccc2c(c1)Cc1cc(S(=O)(=O)NC(C)(C)CO)ccc1-2 |
| InChI | InChI=1S/C21H28N2O6S2/c1-20(2,12-24)22-30(26,27)16-5-7-18-14(10-16)9-15-11-17(6-8-19(15)18)31(28,29)23-21(3,4)13-25/h5-8,10-11,22-25H,9,12-13H2,1-4H3 |
| InChIKey | NCXGXMUEXZFCMP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |