C13H8Na2O6S2 — CID 21178460
disodium;9H-fluorene-2,7-disulfonate (PubChem CID 21178460) has the molecular formula C13H8Na2O6S2 and a molecular weight of 370.32 g/mol. Its IUPAC name is disodium;9H-fluorene-2,7-disulfonate.
| Compound Name | disodium;9H-fluorene-2,7-disulfonate |
|---|---|
| PubChem CID | 21178460 |
| Molecular Formula | C13H8Na2O6S2 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | disodium;9H-fluorene-2,7-disulfonate |
| SMILES | O=S(=O)([O-])c1ccc2c(c1)Cc1cc(S(=O)(=O)[O-])ccc1-2.[Na+].[Na+] |
| InChI | InChI=1S/C13H10O6S2.2Na/c14-20(15,16)10-1-3-12-8(6-10)5-9-7-11(21(17,18)19)2-4-13(9)12;;/h1-4,6-7H,5H2,(H,14,15,16)(H,17,18,19);;/q;2*+1/p-2 |
| InChIKey | JMVPQOKGYBYQHO-UHFFFAOYSA-L |
| XLogP | -4.93 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | -4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|